What is the molecular formula of behenyl acrylate?
The molecular formula of behenyl acrylate is C25H48O2.
What is the molecular weight of behenyl acrylate?
The molecular weight of behenyl acrylate is 380.6 g/mol.
What is the IUPAC name of behenyl acrylate?
The IUPAC name of behenyl acrylate is docosyl prop-2-enoate.
What is the InChI of behenyl acrylate?
The InChI of behenyl acrylate is InChI=1S/C25H48O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-27-25(26)4-2/h4H,2-3,5-24H2,1H3.
What is the InChIKey of behenyl acrylate?
The InChIKey of behenyl acrylate is KHAYCTOSKLIHEP-UHFFFAOYSA-N.
What is the canonical SMILES of behenyl acrylate?
The canonical SMILES of behenyl acrylate is CCCCCCCCCCCCCCCCCCCCCCOC(=O)C=C.
What is the CAS number of behenyl acrylate?
The CAS number of behenyl acrylate is 18299-85-9.
What is the XLogP3 value of behenyl acrylate?
The XLogP3 value of behenyl acrylate is 11.6.
How many hydrogen bond acceptor count does behenyl acrylate have?
Behenyl acrylate has 2 hydrogen bond acceptor counts.
What is the topological polar surface area of behenyl acrylate?
The topological polar surface area of behenyl acrylate is 26.3Ų.