What is the molecular formula of beclomethasone?
The molecular formula of beclomethasone is C22H29ClO5.
What is the molecular weight of beclomethasone?
The molecular weight of beclomethasone is 408.9 g/mol.
What are the synonyms for beclomethasone?
The synonyms for beclomethasone include beclometasone, 4419-39-0, Beclometasona, and Beclometasonum.
What is the IUPAC name of beclomethasone?
The IUPAC name of beclomethasone is (8S,9R,10S,11S,13S,14S,16S,17R)-9-chloro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one.
What is the InChI of beclomethasone?
The InChI of beclomethasone is InChI=1S/C22H29ClO5/c1-12-8-16-15-5-4-13-9-14(25)6-7-19(13,2)21(15,23)17(26)10-20(16,3)22(12,28)18(27)11-24/h6-7,9,12,15-17,24,26,28H,4-5,8,10-11H2,1-3H3/t12-,15-,16-,17-,19-,20-,21-,22-/m0/s1.
What is the InChIKey of beclomethasone?
The InChIKey of beclomethasone is NBMKJKDGKREAPL-DVTGEIKXSA-N.
What is the Canonical SMILES of beclomethasone?
The Canonical SMILES of beclomethasone is CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)CO)O)C)O)Cl)C.
What is the CAS number of beclomethasone?
The CAS number of beclomethasone is 4419-39-0.
What is the ChEMBL ID of beclomethasone?
The ChEMBL ID of beclomethasone is CHEMBL1586.
What is the Wikipedia page for beclomethasone?
The Wikipedia page for beclomethasone is "Beclometasone".