What is the molecular formula of b-Bromo-b-phenylpropionic acid?
The molecular formula of b-Bromo-b-phenylpropionic acid is C9H9BrO2.
What are the synonyms for b-Bromo-b-phenylpropionic acid?
The synonyms for b-Bromo-b-phenylpropionic acid are 3-Bromo-3-phenylpropanoic acid, 15463-91-9, b-bromobenzenepropanoic acid, and 3-Bromo-3-phenylpropionic acid.
When was b-Bromo-b-phenylpropionic acid created?
b-Bromo-b-phenylpropionic acid was created on March 26, 2005.
What is the molecular weight of b-Bromo-b-phenylpropionic acid?
The molecular weight of b-Bromo-b-phenylpropionic acid is 229.07 g/mol.
What is the IUPAC name of b-Bromo-b-phenylpropionic acid?
The IUPAC name of b-Bromo-b-phenylpropionic acid is 3-bromo-3-phenylpropanoic acid.
What is the InChI of b-Bromo-b-phenylpropionic acid?
The InChI of b-Bromo-b-phenylpropionic acid is InChI=1S/C9H9BrO2/c10-8(6-9(11)12)7-4-2-1-3-5-7/h1-5,8H,6H2,(H,11,12).
What is the InChIKey of b-Bromo-b-phenylpropionic acid?
The InChIKey of b-Bromo-b-phenylpropionic acid is JQRMHJWFYKSDNQ-UHFFFAOYSA-N.
What is the canonical SMILES of b-Bromo-b-phenylpropionic acid?
The canonical SMILES of b-Bromo-b-phenylpropionic acid is C1=CC=C(C=C1)C(CC(=O)O)Br.
What is the CAS number of b-Bromo-b-phenylpropionic acid?
The CAS number of b-Bromo-b-phenylpropionic acid is 15463-91-9.
What is the XLogP3 value of b-Bromo-b-phenylpropionic acid?
The XLogP3 value of b-Bromo-b-phenylpropionic acid is 2.6.
※ Please kindly note that our products are for research use only.