AURAMINE O

• CAS: 2465-27-2
• Catalog Number: ACM2465272
• Category: Basic Dyes
• Molecular Weight: 303.83
• Molecular Formula: C₁₇H₂₁N₃.HCl

Custom Q&A

What is the molecular formula of Auramine O according to the reference?

The molecular formula of Auramine O is C17H21N3.ClH or C17H22ClN3.

What is the molecular weight of Auramine O?

The molecular weight of Auramine O is 303.8 g/mol.

What are some synonyms for Auramine O?

Some synonyms for Auramine O include Basic Yellow 2, AURAMINE HYDROCHLORIDE, and Auramin.

What role does Auramine O have according to the reference?

Auramine O has a role as a fluorochrome and a histological dye.

What is the IUPAC name of Auramine O?

The IUPAC name of Auramine O is 4-[4-(dimethylamino)benzenecarboximidoyl]-N,N-dimethylaniline;hydrochloride.

What is the InChIKey of Auramine O?

The InChIKey of Auramine O is KSCQDDRPFHTIRL-UHFFFAOYSA-N.

What is the Canonical SMILES of Auramine O?

The Canonical SMILES of Auramine O is CN(C)C1=CC=C(C=C1)C(=N)C2=CC=C(C=C2)N(C)C.Cl.

What is the CAS number for Auramine O?

The CAS number for Auramine O is 2465-27-2.

What are some other identifiers for Auramine O?

Some other identifiers for Auramine O include ChEMBL ID CHEMBL1612246 and UNII DL992L7W39.

What are some computed properties of Auramine O?

Some computed properties of Auramine O include a hydrogen bond donor count of 2, a hydrogen bond acceptor count of 3, and a rotatable bond count of 4.