What is the molecular formula of Aposcopolamine?
The molecular formula of Aposcopolamine is C17H19NO3.
What are the synonyms for Aposcopolamine?
The synonyms for Aposcopolamine are Apohyoscine, 535-26-2, RQ98RV32RG, and UNII-RQ98RV32RG.
What is the molecular weight of Aposcopolamine?
The molecular weight of Aposcopolamine is 285.34 g/mol.
When was Aposcopolamine created?
Aposcopolamine was created on August 9, 2005.
When was Aposcopolamine last modified?
Aposcopolamine was last modified on October 21, 2023.
What is the IUPAC name of Aposcopolamine?
The IUPAC name of Aposcopolamine is [(1S,2S,4R,5R)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl] 2-phenylprop-2-enoate.
What is the InChI of Aposcopolamine?
The InChI of Aposcopolamine is InChI=1S/C17H19NO3/c1-10(11-6-4-3-5-7-11)17(19)20-12-8-13-15-16(21-15)14(9-12)18(13)2/h3-7,12-16H,1,8-9H2,2H3/t12?,13-,14+,15-,16+.
What is the InChIKey of Aposcopolamine?
The InChIKey of Aposcopolamine is JJNVDCBKBUSUII-LHIUVBILSA-N.
What is the canonical SMILES of Aposcopolamine?
The canonical SMILES of Aposcopolamine is CN1C2CC(CC1C3C2O3)OC(=O)C(=C)C4=CC=CC=C4.
What is the UNII of Aposcopolamine?
The UNII of Aposcopolamine is RQ98RV32RG.