What is the molecular formula of amlexanox?
The molecular formula of amlexanox is C16H14N2O4.
What is the molecular weight of amlexanox?
The molecular weight of amlexanox is 298.29 g/mol.
What is the role of amlexanox?
Amlexanox has a role as an anti-allergic agent, an anti-ulcer drug, and a non-steroidal anti-inflammatory drug.
What is the IUPAC name of amlexanox?
The IUPAC name of amlexanox is 2-amino-5-oxo-7-propan-2-ylchromeno[2,3-b]pyridine-3-carboxylic acid.
How is the physiologic effect of amlexanox achieved?
The physiologic effect of amlexanox is achieved by means of Decreased Histamine Release.
What is the InChIKey of amlexanox?
The InChIKey of amlexanox is SGRYPYWGNKJSDL-UHFFFAOYSA-N.
What is the canonical SMILES of amlexanox?
The canonical SMILES of amlexanox is CC(C)C1=CC2=C(C=C1)OC3=NC(=C(C=C3C2=O)C(=O)O)N.
What is the CAS number of amlexanox?
The CAS number of amlexanox is 68302-57-8.
What is the European Community (EC) Number of amlexanox?
The European Community (EC) Number of amlexanox is 804-135-3.
What is the hydrogen bond donor count of amlexanox?
The hydrogen bond donor count of amlexanox is 2.