What is the molecular formula of Aminodiphenylmethane hydrochloride?
The molecular formula of Aminodiphenylmethane hydrochloride is C13H14ClN.
What is the molecular weight of Aminodiphenylmethane hydrochloride?
The molecular weight of Aminodiphenylmethane hydrochloride is 219.71 g/mol.
What are the synonyms of Aminodiphenylmethane hydrochloride?
The synonyms of Aminodiphenylmethane hydrochloride include Benzhydrylamine hydrochloride, diphenylmethanamine hydrochloride, and Benzhydrylammonium chloride.
What is the IUPAC name of Aminodiphenylmethane hydrochloride?
The IUPAC name of Aminodiphenylmethane hydrochloride is diphenylmethanamine;hydrochloride.
What is the InChI of Aminodiphenylmethane hydrochloride?
The InChI of Aminodiphenylmethane hydrochloride is InChI=1S/C13H13N.ClH/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10,13H,14H2;1H.
What is the InChIKey of Aminodiphenylmethane hydrochloride?
The InChIKey of Aminodiphenylmethane hydrochloride is CIHWJRSPVJBHGT-UHFFFAOYSA-N.
What is the canonical SMILES of Aminodiphenylmethane hydrochloride?
The canonical SMILES of Aminodiphenylmethane hydrochloride is C1=CC=C(C=C1)C(C2=CC=CC=C2)N.Cl.
What is the CAS number of Aminodiphenylmethane hydrochloride?
The CAS number of Aminodiphenylmethane hydrochloride is 5267-34-5.
How many hydrogen bond donor count does Aminodiphenylmethane hydrochloride have?
Aminodiphenylmethane hydrochloride has 2 hydrogen bond donor count.
How many hydrogen bond acceptor count does Aminodiphenylmethane hydrochloride have?
Aminodiphenylmethane hydrochloride has 1 hydrogen bond acceptor count.
※ Please kindly note that our products are for research use only.