What is the molecular formula of Aluminum L-lactate?
The molecular formula of Aluminum L-lactate is C9H15AlO9.
What are the synonyms for Aluminum L-lactate?
The synonyms for Aluminum L-lactate include Takiceram, Aluminum L-lactate, 95%, 2500F, Aluminum tris(-hydroxypropionate), and Lohtragon AL 250.
What is the molecular weight of Aluminum L-lactate?
The molecular weight of Aluminum L-lactate is 294.19 g/mol.
When was Aluminum L-lactate created?
Aluminum L-lactate was created on May 17, 2013.
When was Aluminum L-lactate last modified?
Aluminum L-lactate was last modified on October 21, 2023.
What is the IUPAC name of Aluminum L-lactate?
The IUPAC name of Aluminum L-lactate is bis[[(2S)-2-hydroxypropanoyl]oxy]alumanyl (2S)-2-hydroxypropanoate.
What is the InChI of Aluminum L-lactate?
The InChI of Aluminum L-lactate is InChI=1S/3C3H6O3.Al/c3*1-2(4)3(5)6;/h3*2,4H,1H3,(H,5,6);/q;;;+3/p-3/t3*2-;/m000./s1.
What is the InChIKey of Aluminum L-lactate?
The InChIKey of Aluminum L-lactate is VXYADVIJALMOEQ-LGISMKCISA-K.
What is the canonical SMILES of Aluminum L-lactate?
The canonical SMILES of Aluminum L-lactate is CC(C(=O)O[Al](OC(=O)C(C)O)OC(=O)C(C)O)O.
What is the topological polar surface area of Aluminum L-lactate?
The topological polar surface area of Aluminum L-lactate is 140Ų.