What is the molecular weight of alpha-bromostyrene?
The molecular weight of alpha-bromostyrene is 183.04 g/mol.
What is the IUPAC Name of alpha-bromostyrene?
The IUPAC Name of alpha-bromostyrene is 1-bromoethenylbenzene.
What is the InChI of alpha-bromostyrene?
The InChI of alpha-bromostyrene is InChI=1S/C8H7Br/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H2.
What is the InChIKey of alpha-bromostyrene?
The InChIKey of alpha-bromostyrene is SRXJYTZCORKVNA-UHFFFAOYSA-N.
What is the canonical SMILES of alpha-bromostyrene?
The canonical SMILES of alpha-bromostyrene is C=C(C1=CC=CC=C1)Br.
What is the CAS number of alpha-bromostyrene?
The CAS number of alpha-bromostyrene is 98-81-7.
What is the European Community (EC) Number of alpha-bromostyrene?
The European Community (EC) Number of alpha-bromostyrene is 202-702-4.
What is the UNII of alpha-bromostyrene?
The UNII of alpha-bromostyrene is LF0SJ1821N.
What is the DSSTox Substance ID of alpha-bromostyrene?
The DSSTox Substance ID of alpha-bromostyrene is DTXSID70243366.
Is alpha-bromostyrene a canonicalized compound?
Yes, alpha-bromostyrene is a canonicalized compound.