What is the molecular formula of allylidene diacetate?
The molecular formula of allylidene diacetate is C7H10O4.
What is the molecular weight of allylidene diacetate?
The molecular weight of allylidene diacetate is 158.15 g/mol.
What is the IUPAC name of allylidene diacetate?
The IUPAC name of allylidene diacetate is 1-acetyloxyprop-2-enyl acetate.
What is the InChI of allylidene diacetate?
The InChI of allylidene diacetate is InChI=1S/C7H10O4/c1-4-7(10-5(2)8)11-6(3)9/h4,7H,1H2,2-3H3.
What is the InChIKey of allylidene diacetate?
The InChIKey of allylidene diacetate is TXECTBGVEUDNSL-UHFFFAOYSA-N.
What is the canonical SMILES of allylidene diacetate?
The canonical SMILES of allylidene diacetate is CC(=O)OC(C=C)OC(=O)C.
What is the CAS number of allylidene diacetate?
The CAS number of allylidene diacetate is 869-29-4.
What is the EC number of allylidene diacetate?
The EC number of allylidene diacetate is 212-789-0.
What is the UNII of allylidene diacetate?
The UNII of allylidene diacetate is 5VDZ4FX754.
Is allylidene diacetate a canonicalized compound?
Yes, allylidene diacetate is a canonicalized compound.