What is the molecular formula of Aldicarb-sulfoxide?
The molecular formula of Aldicarb-sulfoxide is C7H14N2O3S.
What is the molecular weight of Aldicarb-sulfoxide?
The molecular weight of Aldicarb-sulfoxide is 206.27 g/mol.
What is the IUPAC name of Aldicarb-sulfoxide?
The IUPAC name of Aldicarb-sulfoxide is [(E)-(2-methyl-2-methylsulfinylpropylidene)amino] N-methylcarbamate.
What is the InChI of Aldicarb-sulfoxide?
The InChI of Aldicarb-sulfoxide is InChI=1S/C7H14N2O3S/c1-7(2,13(4)11)5-9-12-6(10)8-3/h5H,1-4H3,(H,8,10)/b9-5+.
What is the InChIKey of Aldicarb-sulfoxide?
The InChIKey of Aldicarb-sulfoxide is BXPMAGSOWXBZHS-WEVVVXLNSA-N.
What is the canonical SMILES of Aldicarb-sulfoxide?
The canonical SMILES of Aldicarb-sulfoxide is CC(C)(C=NOC(=O)NC)S(=O)C.
What is the CAS number of Aldicarb-sulfoxide?
The CAS number of Aldicarb-sulfoxide is 1646-87-3.
What is the European Community (EC) number of Aldicarb-sulfoxide?
The European Community (EC) number of Aldicarb-sulfoxide is 622-554-8.
What is the UNII of Aldicarb-sulfoxide?
The UNII of Aldicarb-sulfoxide is 5X736K018B.