What is the molecular formula of alatrofloxacin?
The molecular formula of alatrofloxacin is C26H25F3N6O5.
When was alatrofloxacin created and modified?
Alatrofloxacin was created on August 9, 2005, and modified on December 30, 2023.
What is the molecular weight of alatrofloxacin?
The molecular weight of alatrofloxacin is 558.5 g/mol.
What is the IUPAC name of alatrofloxacin?
The IUPAC name of alatrofloxacin is 7-[(1S,5R)-6-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]-3-azabicyclo[3.1.0]hexan-3-yl]-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid.
What is the InChI key of alatrofloxacin?
The InChI key of alatrofloxacin is UUZPPAMZDFLUHD-LZGARRQBSA-N.
What is the Canonical SMILES of alatrofloxacin?
The Canonical SMILES of alatrofloxacin is CC(C(=O)NC(C)C(=O)NC1C2C1CN(C2)C3=C(C=C4C(=O)C(=CN(C4=N3)C5=C(C=C(C=C5)F)F)C(=O)O)F)N.
What is the ChEMBL ID of alatrofloxacin?
The ChEMBL ID of alatrofloxacin is CHEMBL1201197.
What is the XLogP3 value of alatrofloxacin?
The XLogP3 value of alatrofloxacin is -0.2.
How many hydrogen bond donor counts does alatrofloxacin have?
Alatrofloxacin has 4 hydrogen bond donor counts.
What is the topological polar surface area of alatrofloxacin?
The topological polar surface area of alatrofloxacin is 158 Å^2.