What is the PubChem CID of Acid Violet 17?
The PubChem CID of Acid Violet 17 is 92205.
What is the molecular formula of Acid Violet 17?
The molecular formula of Acid Violet 17 is C41H44N3NaO6S2.
What is the molecular weight of Acid Violet 17?
The molecular weight of Acid Violet 17 is 761.9 g/mol.
What is the IUPAC name of Acid Violet 17?
The IUPAC name of Acid Violet 17 is sodium;3-[[4-[[4-(diethylamino)phenyl]-[4-[ethyl-[(3-sulfonatophenyl)methyl]azaniumylidene]cyclohexa-2,5-dien-1-ylidene]methyl]-N-ethylanilino]methyl]benzenesulfonate.
What is the Canonical SMILES of Acid Violet 17?
The Canonical SMILES of Acid Violet 17 is CCN(CC)C1=CC=C(C=C1)C(=C2C=CC(=[N+](CC)CC3=CC(=CC=C3)S(=O)(=O)[O-])C=C2)C4=CC=C(C=C4)N(CC)CC5=CC(=CC=C5)S(=O)(=O)[O-].[Na+].
What is the CAS number of Acid Violet 17?
The CAS number of Acid Violet 17 is 4129-84-4.
What is the hydrogen bond donor count of Acid Violet 17?
The hydrogen bond donor count of Acid Violet 17 is 0.
What is the hydrogen bond acceptor count of Acid Violet 17?
The hydrogen bond acceptor count of Acid Violet 17 is 8.
What is the rotatable bond count of Acid Violet 17?
The rotatable bond count of Acid Violet 17 is 12.
What is the topological polar surface area of Acid Violet 17?
The topological polar surface area of Acid Violet 17 is 141 ?2.
What is the InChI of Acid Violet 17?
The InChI of Acid Violet 17 is InChI=1S/C41H45N3O6S2.Na/c1-5-42(6-2)36-21-15-33(16-22-36)41(34-17-23-37(24-18-34)43(7-3)29-31-11-9-13-39(27-31)51(45,46)47)35-19-25-38(26-20-35)44(8-4)30-32-12-10-14-40(28-32)52(48,49)50;/h9-28H,5-8,29-30H2,1-4H3,(H-,45,46,47,48,49,50);/q;+1/p-1.
How many rotatable bonds are there in Acid Violet 17?
Acid Violet 17 has 12 rotatable bonds.
How many heavy atoms are there in Acid Violet 17?
Acid Violet 17 has 53 heavy atoms.
What is the exact mass of Acid Violet 17?
The exact mass of Acid Violet 17 is 761.25692276 g/mol.