What is the molecular formula of ACID RED 151?
The molecular formula of ACID RED 151 is C22H15N4NaO4S.
What is the molecular weight of ACID RED 151?
The molecular weight of ACID RED 151 is 454.4 g/mol.
What is the IUPAC name of ACID RED 151?
The IUPAC name of ACID RED 151 is sodium;4-[[4-[(2-hydroxynaphthalen-1-yl)diazenyl]phenyl]diazenyl]benzenesulfonate.
What is the InChI of ACID RED 151?
The InChI of ACID RED 151 is InChI=1S/C22H16N4O4S.Na/c27-21-14-5-15-3-1-2-4-20(15)22(21)26-25-17-8-6-16(7-9-17)23-24-18-10-12-19(13-11-18)31(28,29)30;/h1-14,27H,(H,28,29,30);/q;+1/p-1.
What is the InChIKey of ACID RED 151?
The InChIKey of ACID RED 151 is QERXHBDEEFLTOL-UHFFFAOYSA-M.
What is the CAS number of ACID RED 151?
The CAS number of ACID RED 151 is 6406-56-0.
What is the European Community (EC) Number of ACID RED 151?
The European Community (EC) Number of ACID RED 151 is 229-029-9.
What is the UNII of ACID RED 151?
The UNII of ACID RED 151 is Y3J6BJT64N.
What is the hydrogen bond donor count of ACID RED 151?
The hydrogen bond donor count of ACID RED 151 is 1.
What is the hydrogen bond acceptor count of ACID RED 151?
The hydrogen bond acceptor count of ACID RED 151 is 8.
What is the canonical SMILES of ACID RED 151?
The canonical SMILES of ACID RED 151 is C1=CC=C2C(=C1)C=CC(=C2N=NC3=CC=C(C=C3)N=NC4=CC=C(C=C4)S(=O)(=O)[O-])O.[Na+].
What is the EC number of ACID RED 151?
The EC number of ACID RED 151 is 229-029-9.