What is the molecular formula of Acetyl-L-carnitine?
The molecular formula of Acetyl-L-carnitine is C9H17NO4.
What is the molecular weight of Acetyl-L-carnitine?
The molecular weight of Acetyl-L-carnitine is 203.24 g/mol.
What is the parent compound of Acetyl-L-carnitine?
The parent compound of Acetyl-L-carnitine is O-acetylcarnitine (CID 439756).
Is Acetyl-L-carnitine a human metabolite?
Yes, Acetyl-L-carnitine is a human metabolite.
What is the main role of Acetyl-L-carnitine?
The main role of Acetyl-L-carnitine is to help transport fatty acids into the mitochondrial matrix where fatty acid metabolism occurs.
Where is Acetyl-L-carnitine naturally found?
Acetyl-L-carnitine is naturally found in adequate amounts in healthy humans.
What is the IUPAC name of Acetyl-L-carnitine?
The IUPAC name of Acetyl-L-carnitine is (3R)-3-acetyloxy-4-(trimethylazaniumyl)butanoate.
What is the InChI of Acetyl-L-carnitine?
The InChI of Acetyl-L-carnitine is InChI=1S/C9H17NO4/c1-7(11)14-8(5-9(12)13)6-10(2,3)4/h8H,5-6H2,1-4H3/t8-/m1/s1.
What is the Canonical SMILES of Acetyl-L-carnitine?
The Canonical SMILES of Acetyl-L-carnitine is CC(=O)OC(CC(=O)[O-])C[N+](C)(C).
What is the CAS number of Acetyl-L-carnitine?
The CAS number of Acetyl-L-carnitine is 3040-38-8.