What is the molecular formula of 9H-Fluorene-9-thiol?
The molecular formula of 9H-Fluorene-9-thiol is C13H10S.
What is the molecular weight of 9H-Fluorene-9-thiol?
The molecular weight of 9H-Fluorene-9-thiol is 198.29 g/mol.
What is the IUPAC name of 9H-Fluorene-9-thiol?
The IUPAC name of 9H-Fluorene-9-thiol is 9H-fluorene-9-thiol.
What is the InChI of 9H-Fluorene-9-thiol?
The InChI of 9H-Fluorene-9-thiol is InChI=1S/C13H10S/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8,13-14H.
What is the InChIKey of 9H-Fluorene-9-thiol?
The InChIKey of 9H-Fluorene-9-thiol is GNURAXCIBMZJOG-UHFFFAOYSA-N.
What is the canonical SMILES of 9H-Fluorene-9-thiol?
The canonical SMILES of 9H-Fluorene-9-thiol is C1=CC=C2C(=C1)C(C3=CC=CC=C32)S.
What is the CAS number of 9H-Fluorene-9-thiol?
The CAS number of 9H-Fluorene-9-thiol is 19552-08-0.
What is the EC number of 9H-Fluorene-9-thiol?
The EC number of 9H-Fluorene-9-thiol is 695-625-4.
What is the DSSTox Substance ID of 9H-Fluorene-9-thiol?
The DSSTox Substance ID of 9H-Fluorene-9-thiol is DTXSID20279337.
Is 9H-Fluorene-9-thiol a canonicalized compound?
Yes, 9H-Fluorene-9-thiol is a canonicalized compound.