What is the IUPAC name of the compound with PubChem CID 259286?
The IUPAC name of the compound is 9-iodophenanthrene.
What is the molecular formula of the compound with PubChem CID 259286?
The molecular formula of the compound is C14H9I.
What is the molecular weight of the compound with PubChem CID 259286?
The molecular weight of the compound is 304.12 g/mol.
What is the InChI of the compound with PubChem CID 259286?
The InChI of the compound is InChI=1S/C14H9I/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9H.
What is the InChIKey of the compound with PubChem CID 259286?
The InChIKey of the compound is CBFIPOTVFMLMFQ-UHFFFAOYSA-N.
What is the canonical SMILES of the compound with PubChem CID 259286?
The canonical SMILES of the compound is C1=CC=C2C(=C1)C=C(C3=CC=CC=C23)I.
What is the CAS number of the compound with PubChem CID 259286?
The CAS number of the compound is 17024-12-3.
What is the European Community (EC) number of the compound with PubChem CID 259286?
The European Community (EC) number of the compound is 626-667-3.
What is the DSSTox Substance ID of the compound with PubChem CID 259286?
The DSSTox Substance ID of the compound is DTXSID30293387.
Is the compound with PubChem CID 259286 a canonicalized compound?
Yes, the compound is canonicalized.