What is the molecular formula of 9-Aminophenanthrene?
The molecular formula of 9-Aminophenanthrene is C14H11N.
What is the molecular weight of 9-Aminophenanthrene?
The molecular weight of 9-Aminophenanthrene is 193.24 g/mol.
What is the IUPAC name of 9-Aminophenanthrene?
The IUPAC name of 9-Aminophenanthrene is phenanthren-9-amine.
What is the InChIKey of 9-Aminophenanthrene?
The InChIKey of 9-Aminophenanthrene is KIHQWOBUUIPWAN-UHFFFAOYSA-N.
What is the canonical SMILES of 9-Aminophenanthrene?
The canonical SMILES of 9-Aminophenanthrene is C1=CC=C2C(=C1)C=C(C3=CC=CC=C23)N.
What is the CAS number of 9-Aminophenanthrene?
The CAS number of 9-Aminophenanthrene is 947-73-9.
How many hydrogen bond donor count does 9-Aminophenanthrene have?
9-Aminophenanthrene has 1 hydrogen bond donor count.
How many hydrogen bond acceptor count does 9-Aminophenanthrene have?
9-Aminophenanthrene has 1 hydrogen bond acceptor count.
What is the topological polar surface area of 9-Aminophenanthrene?
The topological polar surface area of 9-Aminophenanthrene is 26Ų.