What is the molecular formula of 7alpha-hydroxycholestanol?
The molecular formula is C27H48O2.
What is the molecular weight of 7alpha-hydroxycholestanol?
The molecular weight is 404.7 g/mol.
When was 7alpha-hydroxycholestanol created?
It was created on June 18, 2007.
When was 7alpha-hydroxycholestanol last modified?
It was last modified on November 25, 2023.
What is the IUPAC name of 7alpha-hydroxycholestanol?
The IUPAC name is (3S,5R,7R,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol.
What is the InChI key of 7alpha-hydroxycholestanol?
The InChI key is APYVEUGLZHAHDJ-BOKMIASKSA-N.
What is the canonical SMILES of 7alpha-hydroxycholestanol?
The canonical SMILES is CC(C)CCCC(C)C1CCC2C1(CCC3C2C(CC4C3(CCC(C4)O)C)O)C.
What is the CAS number of 7alpha-hydroxycholestanol?
The CAS number is 7554-76-9.
What is the ChEMBL ID of 7alpha-hydroxycholestanol?
The ChEMBL ID is CHEMBL2442169.
What is the XLogP3-AA value of 7alpha-hydroxycholestanol?
The XLogP3-AA value is 8.
※ Please kindly note that our products are for research use only.