What is the molecular formula of 7-Methoxyindole?
The molecular formula of 7-Methoxyindole is C9H9NO.
What is the molecular weight of 7-Methoxyindole?
The molecular weight of 7-Methoxyindole is 147.17 g/mol.
What is the IUPAC name of 7-Methoxyindole?
The IUPAC name of 7-Methoxyindole is 7-methoxy-1H-indole.
What is the InChI of 7-Methoxyindole?
The InChI of 7-Methoxyindole is InChI=1S/C9H9NO/c1-11-8-4-2-3-7-5-6-10-9(7)8/h2-6,10H,1H3.
What is the InChIKey of 7-Methoxyindole?
The InChIKey of 7-Methoxyindole is FSOPPXYMWZOKRM-UHFFFAOYSA-N.
What is the canonical SMILES of 7-Methoxyindole?
The canonical SMILES of 7-Methoxyindole is COC1=CC=CC2=C1NC=C2.
What is the CAS number of 7-Methoxyindole?
The CAS number of 7-Methoxyindole is 3189-22-8.
What is the European Community (EC) Number of 7-Methoxyindole?
The European Community (EC) Number of 7-Methoxyindole is 221-690-1.
What is the ChEMBL ID of 7-Methoxyindole?
The ChEMBL ID of 7-Methoxyindole is CHEMBL2018156.
Is 7-Methoxyindole a canonicalized compound?
Yes, 7-Methoxyindole is a canonicalized compound according to PubChem.