What is the molecular formula of 7-Chlorotryptophan?
The molecular formula of 7-Chlorotryptophan is C11H11ClN2O2.
What is the molecular weight of 7-Chlorotryptophan?
The molecular weight of 7-Chlorotryptophan is 238.67 g/mol.
What are some synonyms for 7-Chlorotryptophan?
Some synonyms for 7-Chlorotryptophan include 7-chloro-L-tryptophan, 73945-46-7, (S)-2-amino-3-(7-chloro-1H-indol-3-yl)propanoic acid, and more.
When was 7-Chlorotryptophan created and last modified?
7-Chlorotryptophan was created on 2005-08-09 and last modified on 2023-12-30.
What is the IUPAC Name of 7-Chlorotryptophan?
The IUPAC Name of 7-Chlorotryptophan is (2S)-2-amino-3-(7-chloro-1H-indol-3-yl)propanoic acid.
What is the InChIKey of 7-Chlorotryptophan?
The InChIKey of 7-Chlorotryptophan is DMQFGLHRDFQKNR-VIFPVBQESA-N.
What is the Canonical SMILES of 7-Chlorotryptophan?
The Canonical SMILES of 7-Chlorotryptophan is C1=CC2=C(C(=C1)Cl)NC=C2CC(C(=O)O)N.
How many hydrogen bond donor counts does 7-Chlorotryptophan have?
7-Chlorotryptophan has 3 hydrogen bond donor counts.
What is the XLogP3 value of 7-Chlorotryptophan?
The XLogP3 value of 7-Chlorotryptophan is -0.4.
What is the complexity value of 7-Chlorotryptophan?
The complexity value of 7-Chlorotryptophan is 275.