What is the molecular formula of 7-Bromo-1H-indene?
The molecular formula of 7-Bromo-1H-indene is C9H7Br.
What is the molecular weight of 7-Bromo-1H-indene?
The molecular weight of 7-Bromo-1H-indene is 195.06 g/mol.
What is the IUPAC name of 7-Bromo-1H-indene?
The IUPAC name of 7-Bromo-1H-indene is 7-bromo-1H-indene.
What is the InChI of 7-Bromo-1H-indene?
The InChI of 7-Bromo-1H-indene is InChI=1S/C9H7Br/c10-9-6-2-4-7-3-1-5-8(7)9/h1-4,6H,5H2.
What is the InChIKey of 7-Bromo-1H-indene?
The InChIKey of 7-Bromo-1H-indene is JTRQKQGKIYROIO-UHFFFAOYSA-N.
What is the canonical SMILES of 7-Bromo-1H-indene?
The canonical SMILES of 7-Bromo-1H-indene is C1C=CC2=C1C(=CC=C2)Br.
What is the CAS number of 7-Bromo-1H-indene?
The CAS number of 7-Bromo-1H-indene is 16657-07-1.
What is the XLogP3-AA value of 7-Bromo-1H-indene?
The XLogP3-AA value of 7-Bromo-1H-indene is 3.4.
What is the hydrogen bond donor count of 7-Bromo-1H-indene?
The hydrogen bond donor count of 7-Bromo-1H-indene is 0.
Is 7-Bromo-1H-indene a canonicalized compound?
Yes, 7-Bromo-1H-indene is a canonicalized compound.