The molecular formula of flunisolide is C24H31FO6.
What is the molecular weight of flunisolide?
The molecular weight of flunisolide is 434.5 g/mol.
What is the IUPAC name of flunisolide?
The IUPAC name of flunisolide is (1S,2S,4R,8S,9S,11S,12S,13R,19S)-19-fluoro-11-hydroxy-8-(2-hydroxyacetyl)-6,6,9,13-tetramethyl-5,7-dioxapentacyclo[10.8.0.0 2,9 .0 4,8 .0 13,18 ]icosa-14,17-dien-16-one.
What is the InChI of flunisolide?
The InChI of flunisolide is InChI=1S/C24H31FO6/c1-21(2)30-19-9-14-13-8-16(25)15-7-12(27)5-6-22(15,3)20(13)17(28)10-23(14,4)24(19,31-21)18(29)11-26/h5-7,13-14,16-17,19-20,26,28H,8-11H2,1-4H3/t13-,14-,16-,17-,19+,20+,22-,23-,24+/m0/s1.
What is the InChIKey of flunisolide?
The InChIKey of flunisolide is XSFJVAJPIHIPKU-XWCQMRHXSA-N.
What is the canonical SMILES of flunisolide?
The canonical SMILES of flunisolide is CC1(OC2CC3C4CC(C5=CC(=O)C=CC5(C4C(CC3(C2(O1)C(=O)CO)C)O)C)F)C.
What is the CAS number of flunisolide?
The CAS number of flunisolide is 3385-03-3.
What is the ChEMBL ID of flunisolide?
The ChEMBL ID of flunisolide is CHEMBL1512.
What is the UNII of flunisolide?
The UNII of flunisolide is 78M02AA8KF.
What is the FDA Pharm Classes of flunisolide?
The FDA Pharm Classes of flunisolide are not mentioned in the reference provided.
※ Please kindly note that our products are for research use only.