What is the molecular formula of 6-phenyldodecane?
The molecular formula of 6-phenyldodecane is C18H30.
What are the synonyms for 6-phenyldodecane?
The synonyms for 6-phenyldodecane are 2719-62-2, Benzene, (1-pentylheptyl)-, dodecan-6-ylbenzene, and Dodecane, 6-phenyl-.
What is the molecular weight of 6-phenyldodecane?
The molecular weight of 6-phenyldodecane is 246.4 g/mol.
When was 6-phenyldodecane created?
6-phenyldodecane was created on March 27, 2005.
When was 6-phenyldodecane last modified?
6-phenyldodecane was last modified on October 21, 2023.
What is the IUPAC name of 6-phenyldodecane?
The IUPAC name of 6-phenyldodecane is dodecan-6-ylbenzene.
What is the InChI of 6-phenyldodecane?
The InChI of 6-phenyldodecane is InChI=1S/C18H30/c1-3-5-7-10-14-17(13-9-6-4-2)18-15-11-8-12-16-18/h8,11-12,15-17H,3-7,9-10,13-14H2,1-2H3.
What is the InChIKey of 6-phenyldodecane?
The InChIKey of 6-phenyldodecane is ZYHJQFMTTFCBKH-UHFFFAOYSA-N.
What is the canonical SMILES of 6-phenyldodecane?
The canonical SMILES of 6-phenyldodecane is CCCCCC(CC1=CC=CC=C1)C1=CC=CC=C1.
What is the CAS number of 6-phenyldodecane?
The CAS number of 6-phenyldodecane is 2719-62-2.