What is the molecular formula of 6-Methylpyrazine-2-carboxylic acid?
The molecular formula of 6-Methylpyrazine-2-carboxylic acid is C6H6N2O2.
What are the synonyms for 6-Methylpyrazine-2-carboxylic acid?
The synonyms for 6-Methylpyrazine-2-carboxylic acid are 5521-61-9, Pyrazinecarboxylic acid, 6-methyl-, 6-METHYL-2-PYRAZINECARBOXYLIC ACID, and 2-METHYLPYRAZINE-6-CARBOXYLIC ACID.
What is the molecular weight of 6-Methylpyrazine-2-carboxylic acid?
The molecular weight of 6-Methylpyrazine-2-carboxylic acid is 138.12 g/mol.
What is the IUPAC name of 6-Methylpyrazine-2-carboxylic acid?
The IUPAC name of 6-Methylpyrazine-2-carboxylic acid is 6-methylpyrazine-2-carboxylic acid.
What is the InChI of 6-Methylpyrazine-2-carboxylic acid?
The InChI of 6-Methylpyrazine-2-carboxylic acid is InChI=1S/C6H6N2O2/c1-4-2-7-3-5(8-4)6(9)10/h2-3H,1H3,(H,9,10).
What is the InChIKey of 6-Methylpyrazine-2-carboxylic acid?
The InChIKey of 6-Methylpyrazine-2-carboxylic acid is YDSUJIRXXROKQG-UHFFFAOYSA-N.
What is the CAS number of 6-Methylpyrazine-2-carboxylic acid?
The CAS number of 6-Methylpyrazine-2-carboxylic acid is 5521-61-9.
What is the EC number of 6-Methylpyrazine-2-carboxylic acid?
The EC number of 6-Methylpyrazine-2-carboxylic acid is 837-636-0.
What is the UNII of 6-Methylpyrazine-2-carboxylic acid?
The UNII of 6-Methylpyrazine-2-carboxylic acid is IEL6N911F0.
What is the XLogP3 value of 6-Methylpyrazine-2-carboxylic acid?
The XLogP3 value of 6-Methylpyrazine-2-carboxylic acid is 0.5.
※ Please kindly note that our products are for research use only.