What is the molecular formula of 6-Methoxyindole?
The molecular formula of 6-Methoxyindole is C9H9NO.
What is the molecular weight of 6-Methoxyindole?
The molecular weight of 6-Methoxyindole is 147.17 g/mol.
What is the IUPAC name of 6-Methoxyindole?
The IUPAC name of 6-Methoxyindole is 6-methoxy-1H-indole.
What is the InChI of 6-Methoxyindole?
The InChI of 6-Methoxyindole is InChI=1S/C9H9NO/c1-11-8-3-2-7-4-5-10-9(7)6-8/h2-6,10H,1H3.
What is the InChIKey of 6-Methoxyindole?
The InChIKey of 6-Methoxyindole is QJRWYBIKLXNYLF-UHFFFAOYSA-N.
What is the canonical SMILES of 6-Methoxyindole?
The canonical SMILES of 6-Methoxyindole is COC1=CC2=C(C=C1)C=CN2.
What is the CAS number of 6-Methoxyindole?
The CAS number of 6-Methoxyindole is 3189-13-7.
What is the EC number of 6-Methoxyindole?
The EC number of 6-Methoxyindole is 221-689-6.
What is the XLogP3 value of 6-Methoxyindole?
The XLogP3 value of 6-Methoxyindole is 2.6.
Is 6-Methoxyindole a canonicalized compound?
Yes, 6-Methoxyindole is a canonicalized compound.