What is the PubChem CID of 6-Ketoestriol?
The PubChem CID of 6-Ketoestriol is 11876959.
What is the molecular formula of 6-Ketoestriol?
The molecular formula of 6-Ketoestriol is C18H22O4.
What are some synonyms of 6-Ketoestriol?
Some synonyms of 6-Ketoestriol are 6-Oxoestriol, 6-Oxoestratriol, and 7323-86-6.
What is the molecular weight of 6-Ketoestriol?
The molecular weight of 6-Ketoestriol is 302.4 g/mol.
When was 6-Ketoestriol created?
6-Ketoestriol was created on November 9, 2006.
When was 6-Ketoestriol last modified?
6-Ketoestriol was last modified on November 25, 2023.
What is the IUPAC name of 6-Ketoestriol?
The IUPAC name of 6-Ketoestriol is (8R,9S,13S,14S,16R,17R)-3,16,17-trihydroxy-13-methyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one.
What is the InChIKey of 6-Ketoestriol?
The InChIKey of 6-Ketoestriol is PYFIDTBVOMQKDC-XCYHEEQWSA-N.
What is the canonical SMILES of 6-Ketoestriol?
The canonical SMILES of 6-Ketoestriol is CC12CCC3C(C1CC(C2O)O)CC(=O)C4=C3C=CC(=C4)O.
How many hydrogen bond donor counts does 6-Ketoestriol have?
6-Ketoestriol has 3 hydrogen bond donor counts.