What is the PubChem CID for 6-Dehydropregesteron?
The PubChem CID for 6-Dehydropregesteron is 101994.
What is the molecular formula of 6-Dehydropregesteron?
The molecular formula of 6-Dehydropregesteron is C21H28O2.
What is the molecular weight of 6-Dehydropregesteron?
The molecular weight of 6-Dehydropregesteron is 312.4 g/mol.
What is the IUPAC Name of 6-Dehydropregesteron?
The IUPAC Name of 6-Dehydropregesteron is (8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
What is the InChI of 6-Dehydropregesteron?
The InChI of 6-Dehydropregesteron is InChI=1S/C21H28O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h4-5,12,16-19H,6-11H2,1-3H3/t16-,17+,18-,19-,20-,21+/m0/s1.
What is the InChIKey of 6-Dehydropregesteron?
The InChIKey of 6-Dehydropregesteron is JGMOKGBVKVMRFX-LEKSSAKUSA-N.
What is the Canonical SMILES of 6-Dehydropregesteron?
The Canonical SMILES of 6-Dehydropregesteron is CC(=O)C1CCC2C1(CCC3C2C=CC4=CC(=O)CCC34C).
What is the Isomeric SMILES of 6-Dehydropregesteron?
The Isomeric SMILES of 6-Dehydropregesteron is CC(=O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2C=CC4=CC(=O)CC[C@]34C).
What are the synonyms for 6-Dehydropregesteron?
The synonyms for 6-Dehydropregesteron are Pregna-4,6-diene-3,20-dione, 1162-56-7, 6-Dehydroprogesterone, Delta-6-progesterone, Dydrogesterone impurity B.
What is the CAS number for 6-Dehydropregesteron?
The CAS number for 6-Dehydropregesteron is 1162-56-7.