What is the molecular formula of 6-Cyclopropylpyridine-3-boronic acid?
The molecular formula is C8H10BNO2.
What are the synonyms for 6-Cyclopropylpyridine-3-boronic acid?
The synonyms are (6-Cyclopropylpyridin-3-yl)boronic acid, 1253055-87-6, 6-cyclopropylpyridin-3-ylboronic acid, and B-(6-Cyclopropyl-3-pyridinyl)boronic acid.
What is the molecular weight of 6-Cyclopropylpyridine-3-boronic acid?
The molecular weight is 162.98 g/mol.
When was 6-Cyclopropylpyridine-3-boronic acid created and modified?
It was created on August 29, 2011, and last modified on December 2, 2023.
What is the IUPAC name of 6-Cyclopropylpyridine-3-boronic acid?
The IUPAC name is (6-cyclopropylpyridin-3-yl)boronic acid.
What is the InChI of 6-Cyclopropylpyridine-3-boronic acid?
The InChI is InChI=1S/C8H10BNO2/c11-9(12)7-3-4-8(10-5-7)6-1-2-6/h3-6,11-12H,1-2H2.
What is the InChIKey of 6-Cyclopropylpyridine-3-boronic acid?
The InChIKey is XVOVUSAFYKSLMU-UHFFFAOYSA-N.
What is the Canonical SMILES of 6-Cyclopropylpyridine-3-boronic acid?
The Canonical SMILES is B(C1=CN=C(C=C1)C2CC2)(O)O.
What is the CAS number of 6-Cyclopropylpyridine-3-boronic acid?
The CAS number is 1253055-87-6.
Is 6-Cyclopropylpyridine-3-boronic acid a canonicalized compound?
Yes, it is a canonicalized compound.
※ Please kindly note that our products are for research use only.