The molecular formula of the compound is C17H27BN2O2.
What is the IUPAC name of the compound?
The IUPAC name of the compound is N-cyclohexyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine.
What is the InChI code of the compound?
The InChI code of the compound is InChI=1S/C17H27BN2O2/c1-16(2)17(3,4)22-18(21-16)14-11-8-12-15(20-14)19-13-9-6-5-7-10-13/h8,11-13H,5-7,9-10H2,1-4H3,(H,19,20).
What is the InChIKey of the compound?
The InChIKey of the compound is AUSZJUACMJASTN-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is B1(OC(C(O1)(C)C)(C)C)C2=NC(=CC=C2)NC3CCCCC3.
What is the CAS number of the compound?
The CAS number of the compound is 1315350-19-6.
What is the molecular weight of the compound?
The molecular weight of the compound is 302.2 g/mol.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does the compound have?
The compound has 4 hydrogen bond acceptor counts.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 43.4Ų.
※ Please kindly note that our products are for research use only.