What is the molecular formula of 6-(Cyclohexyl)pyridine-2-boronic acid pinacol ester?
The molecular formula of 6-(Cyclohexyl)pyridine-2-boronic acid pinacol ester is C17H26BNO2.
What is the molecular weight of 6-(Cyclohexyl)pyridine-2-boronic acid pinacol ester?
The molecular weight of 6-(Cyclohexyl)pyridine-2-boronic acid pinacol ester is 287.2 g/mol.
What is the IUPAC name of 6-(Cyclohexyl)pyridine-2-boronic acid pinacol ester?
The IUPAC name of 6-(Cyclohexyl)pyridine-2-boronic acid pinacol ester is 2-cyclohexyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
What is the InChI of 6-(Cyclohexyl)pyridine-2-boronic acid pinacol ester?
The InChI of 6-(Cyclohexyl)pyridine-2-boronic acid pinacol ester is InChI=1S/C17H26BNO2/c1-16(2)17(3,4)21-18(20-16)15-12-8-11-14(19-15)13-9-6-5-7-10-13/h8,11-13H,5-7,9-10H2,1-4H3.
What is the InChIKey of 6-(Cyclohexyl)pyridine-2-boronic acid pinacol ester?
The InChIKey of 6-(Cyclohexyl)pyridine-2-boronic acid pinacol ester is YPMYNVSTIDZIFI-UHFFFAOYSA-N.
What is the canonical SMILES of 6-(Cyclohexyl)pyridine-2-boronic acid pinacol ester?
The canonical SMILES of 6-(Cyclohexyl)pyridine-2-boronic acid pinacol ester is B1(OC(C(O1)(C)C)(C)C)C2=NC(=CC=C2)C3CCCCC3.
What is the CAS number of 6-(Cyclohexyl)pyridine-2-boronic acid pinacol ester?
The CAS number of 6-(Cyclohexyl)pyridine-2-boronic acid pinacol ester is 1259370-17-6.
What is the DSSTox Substance ID of 6-(Cyclohexyl)pyridine-2-boronic acid pinacol ester?
The DSSTox Substance ID of 6-(Cyclohexyl)pyridine-2-boronic acid pinacol ester is DTXSID40671298.
Is 6-(Cyclohexyl)pyridine-2-boronic acid pinacol ester considered as a canonicalized compound?
Yes, 6-(Cyclohexyl)pyridine-2-boronic acid pinacol ester is considered as a canonicalized compound.
※ Please kindly note that our products are for research use only.