What is the PubChem CID for 6-Chloroquinoline?
The PubChem CID for 6-Chloroquinoline is 69163.
What is the molecular formula of 6-Chloroquinoline?
The molecular formula of 6-Chloroquinoline is C9H6ClN.
What is the molecular weight of 6-Chloroquinoline?
The molecular weight of 6-Chloroquinoline is 163.60 g/mol.
What is the IUPAC name of 6-Chloroquinoline?
The IUPAC name of 6-Chloroquinoline is 6-chloroquinoline.
What is the InChI of 6-Chloroquinoline?
The InChI of 6-Chloroquinoline is InChI=1S/C9H6ClN/c10-8-3-4-9-7(6-8)2-1-5-11-9/h1-6H.
What is the InChIKey of 6-Chloroquinoline?
The InChIKey of 6-Chloroquinoline is GKJSZXGYFJBYRQ-UHFFFAOYSA-N.
What is the canonical SMILES of 6-Chloroquinoline?
The canonical SMILES of 6-Chloroquinoline is C1=CC2=C(C=CC(=C2)Cl)N=C1.
What is the CAS number of 6-Chloroquinoline?
The CAS number of 6-Chloroquinoline is 612-57-7.
What is the European Community (EC) number of 6-Chloroquinoline?
The European Community (EC) number of 6-Chloroquinoline is 210-314-1.
Is 6-Chloroquinoline a canonicalized compound?
Yes, 6-Chloroquinoline is a canonicalized compound according to PubChem.