72-80-0 Purity
98%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula is C9H5ClFN.
The molecular weight is 181.59 g/mol.
The IUPAC name of the compound is 6-chloro-8-fluoroquinoline.
The InChI key of the compound is VRDHJZRIMIKGRW-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC2=CC(=CC(=C2N=C1)F)Cl.
The CAS number of the compound is 52200-53-0.
The XLogP3 value of the compound is 2.8.
The compound has 0 hydrogen bond donor counts.
The compound has 2 hydrogen bond acceptor counts.
The compound has 0 rotatable bond counts.