The synonyms are 1256355-20-0, (6-Butoxy-5-methylpyridin-3-yl)boronic acid, 6-BUTOXY-5-METHYLPYRIDINE-3-BORONIC ACID, and 6-BUTOXY-5-METHYLPHENYLPYRIDINE-3-BORONIC ACID.
What is the molecular weight of the compound?
The molecular weight is 209.05 g/mol.
When was the compound created?
It was created on June 21, 2011.
When was the compound last modified?
It was last modified on December 2, 2023.
What is the IUPAC name of the compound?
The IUPAC name is (6-butoxy-5-methylpyridin-3-yl)boronic acid.
What is the InChI of the compound?
The InChI is InChI=1S/C10H16BNO3/c1-3-4-5-15-10-8(2)6-9(7-12-10)11(13)14/h6-7,13-14H,3-5H2,1-2H3.
What is the InChIKey of the compound?
The InChIKey is CTOSLPPNGNZURB-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES is B(C1=CC(=C(N=C1)OCCCC)C)(O)O.
What is the CAS number of the compound?
The CAS number is 1256355-20-0.
※ Please kindly note that our products are for research use only.