What is the molecular formula of 6-Bronmandrostenedione?
The molecular formula of 6-Bronmandrostenedione is C19H25BrO2.
What is the PubChem CID of 6-Bronmandrostenedione?
The PubChem CID of 6-Bronmandrostenedione is 161972.
What is the molecular weight of 6-Bronmandrostenedione?
The molecular weight of 6-Bronmandrostenedione is 365.3 g/mol.
When was 6-Bronmandrostenedione created?
6-Bronmandrostenedione was created on August 8, 2005.
When was 6-Bronmandrostenedione last modified?
6-Bronmandrostenedione was last modified on December 2, 2023.
What is the IUPAC name of 6-Bronmandrostenedione?
The IUPAC name of 6-Bronmandrostenedione is (6R,8R,9S,10R,13S,14S)-6-bromo-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
What is the InChI of 6-Bronmandrostenedione?
The InChI of 6-Bronmandrostenedione is InChI=1S/C19H25BrO2/c1-18-7-5-11(21)9-15(18)16(20)10-12-13-3-4-17(22)19(13,2)8-6-14(12)18/h9,12-14,16H,3-8,10H2,1-2H3/t12-,13-,14-,16+,18+,19-/m0/s1.
What is the InChIKey of 6-Bronmandrostenedione?
The InChIKey of 6-Bronmandrostenedione is HAWQRBIGKRAICT-DQXCSHPPSA-N.
What is the canonical SMILES of 6-Bronmandrostenedione?
The canonical SMILES of 6-Bronmandrostenedione is CC12CCC3C(C1CCC2=O)CC(C4=CC(=O)CCC34C)Br.
What is the synonym of 6-Bronmandrostenedione?
One of the synonyms of 6-Bronmandrostenedione is 6-Bromoandrostenedione.