What is the PubChem CID of 6-Bromopurine?
The PubChem CID of 6-Bromopurine is 5287830.
What is the molecular formula of 6-Bromopurine?
The molecular formula of 6-Bromopurine is C5H3BrN4.
What is the molecular weight of 6-Bromopurine?
The molecular weight of 6-Bromopurine is 199.01 g/mol.
What is the IUPAC name of 6-Bromopurine?
The IUPAC name of 6-Bromopurine is 6-bromo-7H-purine.
What is the InChI of 6-Bromopurine?
The InChI of 6-Bromopurine is InChI=1S/C5H3BrN4/c6-4-3-5(9-1-7-3)10-2-8-4/h1-2H,(H,7,8,9,10).
What is the InChIKey of 6-Bromopurine?
The InChIKey of 6-Bromopurine is CTGFGRDVWBZYNB-UHFFFAOYSA-N.
What is the canonical SMILES of 6-Bromopurine?
The canonical SMILES of 6-Bromopurine is C1=NC2=C(N1)C(=NC=N2)Br.
What is the CAS number of 6-Bromopurine?
The CAS number of 6-Bromopurine is 767-69-1.
What is the European Community (EC) number of 6-Bromopurine?
The European Community (EC) number of 6-Bromopurine is 212-187-8.
Is 6-Bromopurine a canonicalized compound?
Yes, 6-Bromopurine is a canonicalized compound according to PubChem.