What is the molecular formula of 6-Bromo-N-methylpyrido[2,3-d]pyrimidin-2-amine?
The molecular formula is C8H7BrN4.
What is the molecular weight of 6-Bromo-N-methylpyrido[2,3-d]pyrimidin-2-amine?
The molecular weight is 239.07 g/mol.
When was 6-Bromo-N-methylpyrido[2,3-d]pyrimidin-2-amine created?
It was created on August 19, 2012.
When was 6-Bromo-N-methylpyrido[2,3-d]pyrimidin-2-amine last modified?
It was last modified on December 2, 2023.
What is the IUPAC name of 6-Bromo-N-methylpyrido[2,3-d]pyrimidin-2-amine?
The IUPAC name is 6-bromo-N-methylpyrido[2,3-d]pyrimidin-2-amine.
What is the InChI of 6-Bromo-N-methylpyrido[2,3-d]pyrimidin-2-amine?
The InChI is InChI=1S/C8H7BrN4/c1-10-8-12-3-5-2-6(9)4-11-7(5)13-8/h2-4H,1H3,(H,10,11,12,13).
What is the InChIKey of 6-Bromo-N-methylpyrido[2,3-d]pyrimidin-2-amine?
The InChIKey is PLTBADSHGFJXKA-UHFFFAOYSA-N.
What is the canonical SMILES of 6-Bromo-N-methylpyrido[2,3-d]pyrimidin-2-amine?
The canonical SMILES is CNC1=NC2=NC=C(C=C2C=N1)Br.
What is the CAS number of 6-Bromo-N-methylpyrido[2,3-d]pyrimidin-2-amine?
The CAS number is 882670-90-8.
What is the molecular weight of 6-Bromo-N-methylpyrido[2,3-d]pyrimidin-2-amine computed by PubChem?
The molecular weight is 239.07 g/mol computed by PubChem.