What is the molecular formula of 6-Bromo-2-tetralone?
The molecular formula of 6-Bromo-2-tetralone is C10H9BrO.
What is the molecular weight of 6-Bromo-2-tetralone?
The molecular weight of 6-Bromo-2-tetralone is 225.08 g/mol.
What is the IUPAC name of 6-Bromo-2-tetralone?
The IUPAC name of 6-Bromo-2-tetralone is 6-bromo-3,4-dihydro-1H-naphthalen-2-one.
What is the InChI of 6-Bromo-2-tetralone?
The InChI of 6-Bromo-2-tetralone is InChI=1S/C10H9BrO/c11-9-3-1-8-6-10(12)4-2-7(8)5-9/h1,3,5H,2,4,6H2.
What is the InChIKey of 6-Bromo-2-tetralone?
The InChIKey of 6-Bromo-2-tetralone is BYHKDUFPSJWJDI-UHFFFAOYSA-N.
What is the canonical SMILES of 6-Bromo-2-tetralone?
The canonical SMILES of 6-Bromo-2-tetralone is C1CC2=C(CC1=O)C=CC(=C2)Br.
What is the CAS number of 6-Bromo-2-tetralone?
The CAS number of 6-Bromo-2-tetralone is 4133-35-1.
What is the European Community (EC) number of 6-Bromo-2-tetralone?
The European Community (EC) number of 6-Bromo-2-tetralone is 640-168-8.
What is the DSSTox Substance ID of 6-Bromo-2-tetralone?
The DSSTox Substance ID of 6-Bromo-2-tetralone is DTXSID70369939.
Is 6-Bromo-2-tetralone canonicalized?
Yes, 6-Bromo-2-tetralone is canonicalized according to PubChem.