What is the PubChem CID for 6-Bromo-2-naphthoic acid?
The PubChem CID for 6-Bromo-2-naphthoic acid is 4549852.
What is the molecular formula of 6-Bromo-2-naphthoic acid?
The molecular formula of 6-Bromo-2-naphthoic acid is C11H7BrO2.
What is the molecular weight of 6-Bromo-2-naphthoic acid?
The molecular weight of 6-Bromo-2-naphthoic acid is 251.08 g/mol.
What is the IUPAC name of 6-Bromo-2-naphthoic acid?
The IUPAC name of 6-Bromo-2-naphthoic acid is 6-bromonaphthalene-2-carboxylic acid.
What is the InChI key of 6-Bromo-2-naphthoic acid?
The InChI key of 6-Bromo-2-naphthoic acid is NPMCAVBMOTZUPD-UHFFFAOYSA-N.
What is the canonical SMILES of 6-Bromo-2-naphthoic acid?
The canonical SMILES of 6-Bromo-2-naphthoic acid is C1=CC2=C(C=CC(=C2)Br)C=C1C(=O)O.
What is the CAS number of 6-Bromo-2-naphthoic acid?
The CAS number of 6-Bromo-2-naphthoic acid is 5773-80-8.
What is the XLogP3 value of 6-Bromo-2-naphthoic acid?
The XLogP3 value of 6-Bromo-2-naphthoic acid is 4.
How many hydrogen bond donor counts does 6-Bromo-2-naphthoic acid have?
6-Bromo-2-naphthoic acid has 1 hydrogen bond donor count.
What is the topological polar surface area of 6-Bromo-2-naphthoic acid?
The topological polar surface area of 6-Bromo-2-naphthoic acid is 37.3Ų.