What is the PubChem CID for 6-Aminohexanamide?
The PubChem CID for 6-Aminohexanamide is 67798.
What is the molecular formula of 6-Aminohexanamide?
The molecular formula of 6-Aminohexanamide is C6H14N2O.
What is the molecular weight of 6-Aminohexanamide?
The molecular weight of 6-Aminohexanamide is 130.19 g/mol.
What is the IUPAC name of 6-Aminohexanamide?
The IUPAC name of 6-Aminohexanamide is 6-aminohexanamide.
What is the InChI of 6-Aminohexanamide?
The InChI of 6-Aminohexanamide is InChI=1S/C6H14N2O/c7-5-3-1-2-4-6(8)9/h1-5,7H2,(H2,8,9).
What is the Canonical SMILES of 6-Aminohexanamide?
The Canonical SMILES of 6-Aminohexanamide is C(CCC(=O)N)CCN.
What is the CAS number of 6-Aminohexanamide?
The CAS number of 6-Aminohexanamide is 373-04-6.
What is the European Community (EC) number of 6-Aminohexanamide?
The European Community (EC) number of 6-Aminohexanamide is 206-762-2.
What is the XLogP3 value of 6-Aminohexanamide?
The XLogP3 value of 6-Aminohexanamide is -1.3.
Is 6-Aminohexanamide a canonical compound?
Yes, 6-Aminohexanamide is a canonical compound.