723280-94-2 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C6H4Br2N4.
The molecular weight of the compound is 291.93 g/mol.
The CAS number of the compound is 1198475-31-8.
The IUPAC name of the compound is 6,8-dibromo-2-methyl-[1,2,4]triazolo[1,5-a]pyrazine.
The InChI code of the compound is InChI=1S/C6H4Br2N4/c1-3-9-6-5(8)10-4(7)2-12(6)11-3/h2H,1H3.
The InChIKey of the compound is RRSNBXYGYCPJBV-UHFFFAOYSA-N.
The XLogP3-AA value of the compound is 2.1.
The compound has 0 hydrogen bond donor counts.
The compound has 3 hydrogen bond acceptor counts.
No, the compound does not have any defined atom, undefined atom, defined bond, or undefined bond stereocenter counts.
Download
×