What is the molecular formula of 5-(Trifluoromethyl)-2,1,3-benzothiadiazole?
The molecular formula is C7H3F3N2S.
What is the molecular weight of 5-(Trifluoromethyl)-2,1,3-benzothiadiazole?
The molecular weight is 204.17 g/mol.
What is the IUPAC name of 5-(Trifluoromethyl)-2,1,3-benzothiadiazole?
The IUPAC name is 5-(trifluoromethyl)-2,1,3-benzothiadiazole.
What is the InChI of 5-(Trifluoromethyl)-2,1,3-benzothiadiazole?
The InChI is InChI=1S/C7H3F3N2S/c8-7(9,10)4-1-2-5-6(3-4)12-13-11-5/h1-3H.
What is the InChIKey of 5-(Trifluoromethyl)-2,1,3-benzothiadiazole?
The InChIKey is KUFWKXPZEWUROO-UHFFFAOYSA-N.
What is the canonical SMILES of 5-(Trifluoromethyl)-2,1,3-benzothiadiazole?
The canonical SMILES is C1=CC2=NSN=C2C=C1C(F)(F)F.
What is the CAS number of 5-(Trifluoromethyl)-2,1,3-benzothiadiazole?
The CAS number is 17754-05-1.
What is the European Community (EC) number of 5-(Trifluoromethyl)-2,1,3-benzothiadiazole?
The European Community (EC) number is 671-959-6.
What is the DSSTox Substance ID of 5-(Trifluoromethyl)-2,1,3-benzothiadiazole?
The DSSTox Substance ID is DTXSID80380519.
Is 5-(Trifluoromethyl)-2,1,3-benzothiadiazole a canonicalized compound?
Yes, it is a canonicalized compound.