What is the molecular formula of 5-Methylhexanoic acid?
The molecular formula of 5-Methylhexanoic acid is C7H14O2.
What is the molecular weight of 5-Methylhexanoic acid?
The molecular weight of 5-Methylhexanoic acid is 130.18 g/mol.
What is the IUPAC name of 5-Methylhexanoic acid?
The IUPAC name of 5-Methylhexanoic acid is 5-methylhexanoic acid.
What is the InChI code of 5-Methylhexanoic acid?
The InChI code of 5-Methylhexanoic acid is InChI=1S/C7H14O2/c1-6(2)4-3-5-7(8)9/h6H,3-5H2,1-2H3,(H,8,9).
What is the InChIKey of 5-Methylhexanoic acid?
The InChIKey of 5-Methylhexanoic acid is MHPUGCYGQWGLJL-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Methylhexanoic acid?
The canonical SMILES of 5-Methylhexanoic acid is CC(C)CCCC(=O)O.
What is the CAS number of 5-Methylhexanoic acid?
The CAS number of 5-Methylhexanoic acid is 628-46-6.
What is the FEMA number of 5-Methylhexanoic acid?
The FEMA number of 5-Methylhexanoic acid is 3572.
What is the JECFA number of 5-Methylhexanoic acid?
The JECFA number of 5-Methylhexanoic acid is 266.
What is the complexity value of 5-Methylhexanoic acid?
The complexity value of 5-Methylhexanoic acid is 86.9.