What is the PubChem CID of 5-Methyl-1-hexyn-3-ol?
The PubChem CID of 5-Methyl-1-hexyn-3-ol is 143856.
What is the molecular formula of 5-Methyl-1-hexyn-3-ol?
The molecular formula of 5-Methyl-1-hexyn-3-ol is C7H12O.
What is the molecular weight of 5-Methyl-1-hexyn-3-ol?
The molecular weight of 5-Methyl-1-hexyn-3-ol is 112.17 g/mol.
What is the IUPAC name of 5-Methyl-1-hexyn-3-ol?
The IUPAC name of 5-Methyl-1-hexyn-3-ol is 5-methylhex-1-yn-3-ol.
What is the InChI of 5-Methyl-1-hexyn-3-ol?
The InChI of 5-Methyl-1-hexyn-3-ol is InChI=1S/C7H12O/c1-4-7(8)5-6(2)3/h1,6-8H,5H2,2-3H3.
What is the InChIKey of 5-Methyl-1-hexyn-3-ol?
The InChIKey of 5-Methyl-1-hexyn-3-ol is NTNUBJHPRAMQPC-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Methyl-1-hexyn-3-ol?
The canonical SMILES of 5-Methyl-1-hexyn-3-ol is CC(C)CC(C#C)O.
What is the CAS number of 5-Methyl-1-hexyn-3-ol?
The CAS number of 5-Methyl-1-hexyn-3-ol is 61996-79-0.
What is the XLogP3-AA value of 5-Methyl-1-hexyn-3-ol?
The XLogP3-AA value of 5-Methyl-1-hexyn-3-ol is 1.4.
Is 5-Methyl-1-hexyn-3-ol a canonicalized compound?
Yes, 5-Methyl-1-hexyn-3-ol is a canonicalized compound.