What is the PubChem CID of 5-Formyl-2-methoxyphenylboronic acid?
The PubChem CID of 5-Formyl-2-methoxyphenylboronic acid is 2734367.
What is the molecular formula of 5-Formyl-2-methoxyphenylboronic acid?
The molecular formula of 5-Formyl-2-methoxyphenylboronic acid is C8H9BO4.
What are some synonyms for 5-Formyl-2-methoxyphenylboronic acid?
Some synonyms for 5-Formyl-2-methoxyphenylboronic acid include 127972-02-5, 2-Methoxy-5-formylphenylboronic acid, and (5-formyl-2-methoxyphenyl)boronic acid.
What is the molecular weight of 5-Formyl-2-methoxyphenylboronic acid?
The molecular weight of 5-Formyl-2-methoxyphenylboronic acid is 179.97 g/mol.
When was 5-Formyl-2-methoxyphenylboronic acid created?
5-Formyl-2-methoxyphenylboronic acid was created on July 19, 2005.
What is the IUPAC name of 5-Formyl-2-methoxyphenylboronic acid?
The IUPAC name of 5-Formyl-2-methoxyphenylboronic acid is (5-formyl-2-methoxyphenyl)boronic acid.
What is the InChI of 5-Formyl-2-methoxyphenylboronic acid?
The InChI of 5-Formyl-2-methoxyphenylboronic acid is InChI=1S/C8H9BO4/c1-13-8-3-2-6(5-10)4-7(8)9(11)12/h2-5,11-12H,1H3.
What is the InChIKey of 5-Formyl-2-methoxyphenylboronic acid?
The InChIKey of 5-Formyl-2-methoxyphenylboronic acid is NKKNXLPHCRLBDY-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Formyl-2-methoxyphenylboronic acid?
The canonical SMILES of 5-Formyl-2-methoxyphenylboronic acid is B(C1=C(C=CC(=C1)C=O)OC)(O)O.
What is the CAS number of 5-Formyl-2-methoxyphenylboronic acid?
The CAS number of 5-Formyl-2-methoxyphenylboronic acid is 127972-02-5.
※ Please kindly note that our products are for research use only.