What is the molecular formula of 5-Fluoro-3-methylindole?
The molecular formula of 5-Fluoro-3-methylindole is C9H8FN.
What is the computed molecular weight of 5-Fluoro-3-methylindole?
The computed molecular weight of 5-Fluoro-3-methylindole is 149.16 g/mol.
What is the IUPAC name of 5-Fluoro-3-methylindole?
The IUPAC name of 5-Fluoro-3-methylindole is 5-fluoro-3-methyl-1H-indole.
What is the InChI of 5-Fluoro-3-methylindole?
The InChI of 5-Fluoro-3-methylindole is InChI=1S/C9H8FN/c1-6-5-11-9-3-2-7(10)4-8(6)9/h2-5,11H,1H3.
Are there any hydrogen bond donor and acceptor counts for 5-Fluoro-3-methylindole?
5-Fluoro-3-methylindole has 1 hydrogen bond donor count and 1 hydrogen bond acceptor count.
What is the topological polar surface area of 5-Fluoro-3-methylindole?
The topological polar surface area of 5-Fluoro-3-methylindole is 15.8 Ų.
How many heavy atoms are present in 5-Fluoro-3-methylindole?
There are 11 heavy atoms present in 5-Fluoro-3-methylindole.
Does 5-Fluoro-3-methylindole have any defined or undefined atom stereocenters?
5-Fluoro-3-methylindole does not have any defined or undefined atom stereocenters.
What is the XLogP3 value of 5-Fluoro-3-methylindole?
The XLogP3 value of 5-Fluoro-3-methylindole is 2.7.
Is 5-Fluoro-3-methylindole a canonicalized compound?
Yes, 5-Fluoro-3-methylindole is a canonicalized compound according to PubChem.