What is the PubChem CID of 5-Fluoro-2-methylaniline?
PubChem CID of 5-Fluoro-2-methylaniline is 67774.
What is the molecular formula of 5-Fluoro-2-methylaniline?
The molecular formula of 5-Fluoro-2-methylaniline is C7H8FN.
What is the molecular weight of 5-Fluoro-2-methylaniline?
The molecular weight of 5-Fluoro-2-methylaniline is 125.14 g/mol.
What is the IUPAC name of 5-Fluoro-2-methylaniline?
The IUPAC name of 5-Fluoro-2-methylaniline is 5-fluoro-2-methylaniline.
What is the InChI of 5-Fluoro-2-methylaniline?
The InChI of 5-Fluoro-2-methylaniline is InChI=1S/C7H8FN/c1-5-2-3-6(8)4-7(5)9/h2-4H,9H2,1H3.
What is the InChIKey of 5-Fluoro-2-methylaniline?
The InChIKey of 5-Fluoro-2-methylaniline is JLCDTNNLXUMYFQ-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Fluoro-2-methylaniline?
The canonical SMILES of 5-Fluoro-2-methylaniline is CC1=C(C=C(C=C1)F)N.
What is the CAS number of 5-Fluoro-2-methylaniline?
The CAS number of 5-Fluoro-2-methylaniline is 367-29-3.
What is the European Community (EC) number of 5-Fluoro-2-methylaniline?
The European Community (EC) number of 5-Fluoro-2-methylaniline is 206-689-6.
Is 5-Fluoro-2-methylaniline a canonicalized compound?
Yes, 5-Fluoro-2-methylaniline is a canonicalized compound.