What is the molecular formula of 5-Fluoro-2-hydroxymethylphenylboronic acid?
The molecular formula is C7H8BFO3.
What are the synonyms for 5-Fluoro-2-hydroxymethylphenylboronic acid?
The synonyms are 1246633-53-3, 5-FLUORO-2-HYDROXYMETHYLPHENYLBORONIC ACID, (5-Fluoro-2-(hydroxymethyl)phenyl)boronic acid, [5-fluoro-2-(hydroxymethyl)phenyl]boronic acid, and 5-Fluoro-2-(hydroxymethyl)benzeneboronic acid.
What is the molecular weight of 5-Fluoro-2-hydroxymethylphenylboronic acid?
The molecular weight is 169.95 g/mol.
When was 5-Fluoro-2-hydroxymethylphenylboronic acid created?
It was created on July 26, 2010.
When was 5-Fluoro-2-hydroxymethylphenylboronic acid last modified?
It was last modified on December 2, 2023.
What is the IUPAC name of 5-Fluoro-2-hydroxymethylphenylboronic acid?
The IUPAC name is [5-fluoro-2-(hydroxymethyl)phenyl]boronic acid.
What is the InChI of 5-Fluoro-2-hydroxymethylphenylboronic acid?
The InChI is InChI=1S/C7H8BFO3/c9-6-2-1-5(4-10)7(3-6)8(11)12/h1-3,10-12H,4H2.
What is the InChIKey of 5-Fluoro-2-hydroxymethylphenylboronic acid?
The InChIKey is OBSMVIAXTKAJFM-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Fluoro-2-hydroxymethylphenylboronic acid?
The canonical SMILES is B(C1=C(C=CC(=C1)F)CO)(O)O.
What is the CAS number of 5-Fluoro-2-hydroxymethylphenylboronic acid?
The CAS number is 1246633-53-3.
※ Please kindly note that our products are for research use only.