What is the molecular formula of 5-Chloro-2-iodoaniline?
The molecular formula is C6H5ClIN.
What is the molecular weight of 5-Chloro-2-iodoaniline?
The molecular weight is 253.47 g/mol.
What is the IUPAC name of 5-Chloro-2-iodoaniline?
The IUPAC name is 5-chloro-2-iodoaniline.
What is the InChI of 5-Chloro-2-iodoaniline?
The InChI is InChI=1S/C6H5ClIN/c7-4-1-2-5(8)6(9)3-4/h1-3H,9H2.
What is the InChIKey of 5-Chloro-2-iodoaniline?
The InChIKey is FEOMAFDDLHSVMO-UHFFFAOYSA-N.
What is the Canonical SMILES of 5-Chloro-2-iodoaniline?
The Canonical SMILES is C1=CC(=C(C=C1Cl)N)I.
What is the CAS number of 5-Chloro-2-iodoaniline?
The CAS number is 6828-35-9.
What is the XLogP3-AA value of 5-Chloro-2-iodoaniline?
The XLogP3-AA value is 2.5.
How many hydrogen bond donor count does 5-Chloro-2-iodoaniline have?
It has 1 hydrogen bond donor count.
How many rotatable bond count does 5-Chloro-2-iodoaniline have?
It has 0 rotatable bond count.