What is the molecular formula of 5-Chloro-2-fluorotoluene?
The molecular formula of 5-Chloro-2-fluorotoluene is C7H6ClF.
What is the molecular weight of 5-Chloro-2-fluorotoluene?
The molecular weight of 5-Chloro-2-fluorotoluene is 144.57 g/mol.
What is the IUPAC name of 5-Chloro-2-fluorotoluene?
The IUPAC name of 5-Chloro-2-fluorotoluene is 4-chloro-1-fluoro-2-methylbenzene.
What is the computed InChI of 5-Chloro-2-fluorotoluene?
The computed InChI of 5-Chloro-2-fluorotoluene is InChI=1S/C7H6ClF/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3.
What is the InChIKey of 5-Chloro-2-fluorotoluene?
The InChIKey of 5-Chloro-2-fluorotoluene is JOXXHDGUTVUBDL-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Chloro-2-fluorotoluene?
The canonical SMILES of 5-Chloro-2-fluorotoluene is CC1=C(C=CC(=C1)Cl)F.
What is the CAS number of 5-Chloro-2-fluorotoluene?
The CAS number of 5-Chloro-2-fluorotoluene is 452-66-4.
What is the European Community (EC) number of 5-Chloro-2-fluorotoluene?
The European Community (EC) number of 5-Chloro-2-fluorotoluene is 207-204-0.
What is the DSSTox Substance ID of 5-Chloro-2-fluorotoluene?
The DSSTox Substance ID of 5-Chloro-2-fluorotoluene is DTXSID50196422.
Is 5-Chloro-2-fluorotoluene a canonicalized compound?
Yes, 5-Chloro-2-fluorotoluene is a canonicalized compound.